C34H40N5O2+ — CID 156559208
N-[3-(dimethylamino)propyl]-4-[methyl-[4-[(E)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]butanamide (PubChem CID 156559208) has the molecular formula C34H40N5O2+ and a molecular weight of 550.73 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[methyl-[4-[(E)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]butanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[methyl-[4-[(E)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]butanamide |
|---|---|
| PubChem CID | 156559208 |
| Molecular Formula | C34H40N5O2+ |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[methyl-[4-[(E)-(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]butanamide |
| SMILES | CN(C)CCCNC(=O)CCCN(C)c1cc(/C=C2/Oc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C34H39N5O2/c1-36(2)22-13-21-35-32(40)20-12-23-37(3)33-24-26(25-34-38(4)30-18-10-11-19-31(30)41-34)28-16-8-9-17-29(28)39(33)27-14-6-5-7-15-27/h5-11,14-19,24-25H,12-13,20-23H2,1-4H3/p+1 |
| InChIKey | JEKXEBSTYXYNSW-UHFFFAOYSA-O |
| XLogP | 5.23 |
| TPSA | 51.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|