C35H41N4O2+ — CID 159028497
8-(dimethylamino)-1-[methyl-[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]octan-4-one (PubChem CID 159028497) has the molecular formula C35H41N4O2+ and a molecular weight of 549.74 g/mol. Its IUPAC name is 8-(dimethylamino)-1-[methyl-[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]octan-4-one.
| Compound Name | 8-(dimethylamino)-1-[methyl-[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]octan-4-one |
|---|---|
| PubChem CID | 159028497 |
| Molecular Formula | C35H41N4O2+ |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 8-(dimethylamino)-1-[methyl-[4-[(3-methyl-1,3-benzoxazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]octan-4-one |
| SMILES | CN(C)CCCCC(=O)CCCN(C)c1cc(C=C2Oc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C35H41N4O2/c1-36(2)23-13-12-17-29(40)18-14-24-37(3)34-25-27(26-35-38(4)32-21-10-11-22-33(32)41-35)30-19-8-9-20-31(30)39(34)28-15-6-5-7-16-28/h5-11,15-16,19-22,25-26H,12-14,17-18,23-24H2,1-4H3/q+1 |
| InChIKey | ZICDMDZUXXXFLQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 39.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|