C8H16N2O — CID 156562683
1-(2,3-dimethyl-2,4-dihydropyrimidin-1-yl)ethanol (PubChem CID 156562683) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-(2,3-dimethyl-2,4-dihydropyrimidin-1-yl)ethanol.
| Compound Name | 1-(2,3-dimethyl-2,4-dihydropyrimidin-1-yl)ethanol |
|---|---|
| PubChem CID | 156562683 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-(2,3-dimethyl-2,4-dihydropyrimidin-1-yl)ethanol |
| SMILES | CC(O)N1C=CCN(C)C1C |
| InChI | InChI=1S/C8H16N2O/c1-7-9(3)5-4-6-10(7)8(2)11/h4,6-8,11H,5H2,1-3H3 |
| InChIKey | UOGDNQQDPKWDBW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |