C17H37NOS — CID 156566482
2-[5,5-dimethylhexyl(dimethyl)-λ4-sulfanyl]-N-(2,2-dimethylpropyl)acetamide (PubChem CID 156566482) has the molecular formula C17H37NOS and a molecular weight of 303.56 g/mol. Its IUPAC name is 2-[5,5-dimethylhexyl(dimethyl)-λ4-sulfanyl]-N-(2,2-dimethylpropyl)acetamide.
| Compound Name | 2-[5,5-dimethylhexyl(dimethyl)-λ4-sulfanyl]-N-(2,2-dimethylpropyl)acetamide |
|---|---|
| PubChem CID | 156566482 |
| Molecular Formula | C17H37NOS |
| Molecular Weight | 303.56 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 2-[5,5-dimethylhexyl(dimethyl)-λ4-sulfanyl]-N-(2,2-dimethylpropyl)acetamide |
| SMILES | CC(C)(C)CCCCS(C)(C)CC(=O)NCC(C)(C)C |
| InChI | InChI=1S/C17H37NOS/c1-16(2,3)11-9-10-12-20(7,8)13-15(19)18-14-17(4,5)6/h9-14H2,1-8H3,(H,18,19) |
| InChIKey | MWMOSOVTGAJQEQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|