About 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline
5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline (PubChem CID 156576062) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline.
Molecular Properties
| Compound Name | 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline |
| PubChem CID | 156576062 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline |
| SMILES | COc1ccc(N=S(C)(C)=O)cc1N |
| InChI | InChI=1S/C9H14N2O2S/c1-13-9-5-4-7(6-8(9)10)11-14(2,3)12/h4-6H,10H2,1-3H3 |
| InChIKey | LBLOERMCJRVDMA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline?
The IUPAC name of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline (CID 156576062) is 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline.
What is the SMILES notation for 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline?
The canonical SMILES for 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline is COc1ccc(N=S(C)(C)=O)cc1N.
What is the InChIKey of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline?
The InChIKey is LBLOERMCJRVDMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-13-9-5-4-7(6-8(9)10)11-14(2,3)12/h4-6H,10H2,1-3H3.
What are the key properties of 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline?
5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline has a molecular weight of 214.29 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-methoxyaniline is sourced from PubChem (CID 156576062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).