C11H14ClIN2S — CID 156578203
(7R)-4-chloro-7-iodo-5,5,7-trimethyl-2-methylsulfanyl-6H-cyclopenta[d]pyrimidine (PubChem CID 156578203) has the molecular formula C11H14ClIN2S and a molecular weight of 368.67 g/mol. Its IUPAC name is (7R)-4-chloro-7-iodo-5,5,7-trimethyl-2-methylsulfanyl-6H-cyclopenta[d]pyrimidine.
| Compound Name | (7R)-4-chloro-7-iodo-5,5,7-trimethyl-2-methylsulfanyl-6H-cyclopenta[d]pyrimidine |
|---|---|
| PubChem CID | 156578203 |
| Molecular Formula | C11H14ClIN2S |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | (7R)-4-chloro-7-iodo-5,5,7-trimethyl-2-methylsulfanyl-6H-cyclopenta[d]pyrimidine |
| SMILES | CSc1nc(Cl)c2c(n1)[C@](C)(I)CC2(C)C |
| InChI | InChI=1S/C11H14ClIN2S/c1-10(2)5-11(3,13)7-6(10)8(12)15-9(14-7)16-4/h5H2,1-4H3/t11-/m1/s1 |
| InChIKey | FLMBKEKJSQGDBD-LLVKDONJSA-N |
| XLogP | 4.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|