C17H28O6 — CID 156582571
[(2R,3S,4R,4aR,8S,8aS)-3,4,8a-trihydroxy-2-propyl-2,3,4,4a,5,6,7,8-octahydrochromen-8-yl] 2-methylbut-2-enoate (PubChem CID 156582571) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2R,3S,4R,4aR,8S,8aS)-3,4,8a-trihydroxy-2-propyl-2,3,4,4a,5,6,7,8-octahydrochromen-8-yl] 2-methylbut-2-enoate.
| Compound Name | [(2R,3S,4R,4aR,8S,8aS)-3,4,8a-trihydroxy-2-propyl-2,3,4,4a,5,6,7,8-octahydrochromen-8-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 156582571 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(2R,3S,4R,4aR,8S,8aS)-3,4,8a-trihydroxy-2-propyl-2,3,4,4a,5,6,7,8-octahydrochromen-8-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1CCC[C@@H]2[C@@H](O)[C@H](O)[C@@H](CCC)O[C@]12O |
| InChI | InChI=1S/C17H28O6/c1-4-7-12-15(19)14(18)11-8-6-9-13(17(11,21)23-12)22-16(20)10(3)5-2/h5,11-15,18-19,21H,4,6-9H2,1-3H3/t11-,12-,13+,14-,15-,17+/m1/s1 |
| InChIKey | UUXXSFORGROBMR-QWCKYMPWSA-N |
| XLogP | 1.27 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|