C30H46O8 — CID 102185374
[(1S,2R,3S,4S,5R)-5-[4-(3,3-dimethyloxiran-2-yl)-3-[(Z)-2-methylbut-2-enoxy]but-1-en-2-yl]-2,4-dihydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxycyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 102185374) has the molecular formula C30H46O8 and a molecular weight of 534.69 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R)-5-[4-(3,3-dimethyloxiran-2-yl)-3-[(Z)-2-methylbut-2-enoxy]but-1-en-2-yl]-2,4-dihydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxycyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,2R,3S,4S,5R)-5-[4-(3,3-dimethyloxiran-2-yl)-3-[(Z)-2-methylbut-2-enoxy]but-1-en-2-yl]-2,4-dihydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxycyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102185374 |
| Molecular Formula | C30H46O8 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | [(1S,2R,3S,4S,5R)-5-[4-(3,3-dimethyloxiran-2-yl)-3-[(Z)-2-methylbut-2-enoxy]but-1-en-2-yl]-2,4-dihydroxy-2-methyl-3-[(Z)-2-methylbut-2-enoyl]oxycyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C(CC1OC1(C)C)OC/C(C)=C\C)[C@H]1C[C@H](OC(=O)/C(C)=C\C)[C@@](C)(O)[C@@H](OC(=O)/C(C)=C\C)C1O |
| InChI | InChI=1S/C30H46O8/c1-11-17(4)16-35-22(15-23-29(8,9)38-23)20(7)21-14-24(36-27(32)18(5)12-2)30(10,34)26(25(21)31)37-28(33)19(6)13-3/h11-13,21-26,31,34H,7,14-16H2,1-6,8-10H3/b17-11-,18-12-,19-13-/t21-,22?,23?,24+,25?,26+,30-/m1/s1 |
| InChIKey | HWLZRSKOTPTING-DUCLXDFYSA-N |
| XLogP | 4.35 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|