C27H41ClO9 — CID 162941833
[6-acetyloxy-3-chloro-5-[5,6-dihydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-hydroxy-2-methylcyclohexyl] 2-methylbut-2-enoate (PubChem CID 162941833) has the molecular formula C27H41ClO9 and a molecular weight of 545.07 g/mol. Its IUPAC name is [6-acetyloxy-3-chloro-5-[5,6-dihydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-hydroxy-2-methylcyclohexyl] 2-methylbut-2-enoate.
| Compound Name | [6-acetyloxy-3-chloro-5-[5,6-dihydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-hydroxy-2-methylcyclohexyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162941833 |
| Molecular Formula | C27H41ClO9 |
| Molecular Weight | 545.07 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | [6-acetyloxy-3-chloro-5-[5,6-dihydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-hydroxy-2-methylcyclohexyl] 2-methylbut-2-enoate |
| SMILES | C=C(C(CC(O)C(C)(C)O)OC(=O)C(C)=CC)C1CC(Cl)C(C)(O)C(OC(=O)C(C)=CC)C1OC(C)=O |
| InChI | InChI=1S/C27H41ClO9/c1-10-14(3)24(31)36-19(13-21(30)26(7,8)33)16(5)18-12-20(28)27(9,34)23(22(18)35-17(6)29)37-25(32)15(4)11-2/h10-11,18-23,30,33-34H,5,12-13H2,1-4,6-9H3 |
| InChIKey | FQHWQKTUMOPTLA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|