C28H43ClO9 — CID 162869525
[6-acetyloxy-3-chloro-2-hydroxy-5-[5-hydroxy-6-methoxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-methylcyclohexyl] 2-methylbut-2-enoate (PubChem CID 162869525) has the molecular formula C28H43ClO9 and a molecular weight of 559.10 g/mol. Its IUPAC name is [6-acetyloxy-3-chloro-2-hydroxy-5-[5-hydroxy-6-methoxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-methylcyclohexyl] 2-methylbut-2-enoate.
| Compound Name | [6-acetyloxy-3-chloro-2-hydroxy-5-[5-hydroxy-6-methoxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-methylcyclohexyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162869525 |
| Molecular Formula | C28H43ClO9 |
| Molecular Weight | 559.10 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | [6-acetyloxy-3-chloro-2-hydroxy-5-[5-hydroxy-6-methoxy-6-methyl-3-(2-methylbut-2-enoyloxy)hept-1-en-2-yl]-2-methylcyclohexyl] 2-methylbut-2-enoate |
| SMILES | C=C(C(CC(O)C(C)(C)OC)OC(=O)C(C)=CC)C1CC(Cl)C(C)(O)C(OC(=O)C(C)=CC)C1OC(C)=O |
| InChI | InChI=1S/C28H43ClO9/c1-11-15(3)25(32)37-20(14-22(31)27(7,8)35-10)17(5)19-13-21(29)28(9,34)24(23(19)36-18(6)30)38-26(33)16(4)12-2/h11-12,19-24,31,34H,5,13-14H2,1-4,6-10H3 |
| InChIKey | ZHZZASGVNRBIRD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|