C25H39ClO8 — CID 122403918
[(1S,2S,3S,5R,6S)-3-chloro-5-[5,6-dihydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-2,6-dihydroxy-2-methylcyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 122403918) has the molecular formula C25H39ClO8 and a molecular weight of 503.03 g/mol. Its IUPAC name is [(1S,2S,3S,5R,6S)-3-chloro-5-[5,6-dihydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-2,6-dihydroxy-2-methylcyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,2S,3S,5R,6S)-3-chloro-5-[5,6-dihydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-2,6-dihydroxy-2-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 122403918 |
| Molecular Formula | C25H39ClO8 |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [(1S,2S,3S,5R,6S)-3-chloro-5-[5,6-dihydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-2,6-dihydroxy-2-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C(CC(O)C(C)(C)O)OC(=O)/C(C)=C\C)[C@H]1C[C@H](Cl)[C@@](C)(O)[C@@H](OC(=O)/C(C)=C\C)C1O |
| InChI | InChI=1S/C25H39ClO8/c1-9-13(3)22(29)33-17(12-19(27)24(6,7)31)15(5)16-11-18(26)25(8,32)21(20(16)28)34-23(30)14(4)10-2/h9-10,16-21,27-28,31-32H,5,11-12H2,1-4,6-8H3/b13-9-,14-10-/t16-,17?,18+,19?,20?,21+,25-/m1/s1 |
| InChIKey | TVAKZTCDNGWGFN-IBWBZPRQSA-N |
| XLogP | 2.56 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|