C20H30O4 — CID 6375070
[(3E,5E)-1-(3,3-dimethyloxiran-2-yl)-7-hydroxy-3,7-dimethylnona-3,5,8-trien-2-yl] (E)-2-methylbut-2-enoate (PubChem CID 6375070) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(3E,5E)-1-(3,3-dimethyloxiran-2-yl)-7-hydroxy-3,7-dimethylnona-3,5,8-trien-2-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(3E,5E)-1-(3,3-dimethyloxiran-2-yl)-7-hydroxy-3,7-dimethylnona-3,5,8-trien-2-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 6375070 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [(3E,5E)-1-(3,3-dimethyloxiran-2-yl)-7-hydroxy-3,7-dimethylnona-3,5,8-trien-2-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=CC(C)(O)/C=C/C=C(\C)C(CC1OC1(C)C)OC(=O)/C(C)=C/C |
| InChI | InChI=1S/C20H30O4/c1-8-14(3)18(21)23-16(13-17-19(5,6)24-17)15(4)11-10-12-20(7,22)9-2/h8-12,16-17,22H,2,13H2,1,3-7H3/b12-10+,14-8+,15-11+ |
| InChIKey | VXKDXPKKPDBCSU-QNIZWZRFSA-N |
| XLogP | 3.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|