C27H40Cl2O8 — CID 10674457
[(1R,2R,3R,4R,6S)-2-acetyloxy-4-chloro-6-[(3R,5R)-5-chloro-6-hydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-3-hydroxy-3-methylcyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 10674457) has the molecular formula C27H40Cl2O8 and a molecular weight of 563.52 g/mol. Its IUPAC name is [(1R,2R,3R,4R,6S)-2-acetyloxy-4-chloro-6-[(3R,5R)-5-chloro-6-hydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-3-hydroxy-3-methylcyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2R,3R,4R,6S)-2-acetyloxy-4-chloro-6-[(3R,5R)-5-chloro-6-hydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-3-hydroxy-3-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10674457 |
| Molecular Formula | C27H40Cl2O8 |
| Molecular Weight | 563.52 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | [(1R,2R,3R,4R,6S)-2-acetyloxy-4-chloro-6-[(3R,5R)-5-chloro-6-hydroxy-6-methyl-3-[(Z)-2-methylbut-2-enoyl]oxyhept-1-en-2-yl]-3-hydroxy-3-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C([C@@H](C[C@@H](Cl)C(C)(C)O)OC(=O)/C(C)=C\C)[C@@H]1C[C@@H](Cl)[C@](C)(O)[C@H](OC(C)=O)C1OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C27H40Cl2O8/c1-10-14(3)24(31)36-19(13-20(28)26(7,8)33)16(5)18-12-21(29)27(9,34)23(35-17(6)30)22(18)37-25(32)15(4)11-2/h10-11,18-23,33-34H,5,12-13H2,1-4,6-9H3/b14-10-,15-11-/t18-,19+,20+,21+,22?,23+,27-/m0/s1 |
| InChIKey | ROPABYFOKXHWBR-XNNTVAKSSA-N |
| XLogP | 4.38 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|