C25H32O7 — CID 156583058
(1S,5R,6R,14R,15S,17R,19S,22S)-5,10,15,19-tetrahydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraen-8-one (PubChem CID 156583058) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is (1S,5R,6R,14R,15S,17R,19S,22S)-5,10,15,19-tetrahydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraen-8-one.
| Compound Name | (1S,5R,6R,14R,15S,17R,19S,22S)-5,10,15,19-tetrahydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraen-8-one |
|---|---|
| PubChem CID | 156583058 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (1S,5R,6R,14R,15S,17R,19S,22S)-5,10,15,19-tetrahydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3(12),4(9),10,20-tetraen-8-one |
| SMILES | C[C@H]1OC(=O)c2c(O)cc3c(c2[C@H]1O)C[C@H]1[C@@]2(C)C=C[C@H](O)C(C)(C)[C@@H]2C[C@H](O)[C@]1(C)O3 |
| InChI | InChI=1S/C25H32O7/c1-11-21(29)19-12-8-16-24(4)7-6-17(27)23(2,3)15(24)10-18(28)25(16,5)32-14(12)9-13(26)20(19)22(30)31-11/h6-7,9,11,15-18,21,26-29H,8,10H2,1-5H3/t11-,15+,16+,17+,18+,21+,24+,25-/m1/s1 |
| InChIKey | IVRPGEXHLDGDDF-LHKXSAERSA-N |
| XLogP | 2.64 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|