About 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea
1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea (PubChem CID 156584114) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea.
Molecular Properties
| Compound Name | 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea |
| PubChem CID | 156584114 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea |
| SMILES | CCc1ccc(NC(=O)N[C@@H]2COC[C@H]2Cc2ccncc2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-14-3-5-17(6-4-14)21-19(23)22-18-13-24-12-16(18)11-15-7-9-20-10-8-15/h3-10,16,18H,2,11-13H2,1H3,(H2,21,22,23)/t16-,18-/m1/s1 |
| InChIKey | ALJMHTQFRRAVGP-SJLPKXTDSA-N |
| XLogP | 3.02 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea?
The IUPAC name of 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea (CID 156584114) is 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea.
What is the SMILES notation for 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea?
The canonical SMILES for 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea is CCc1ccc(NC(=O)N[C@@H]2COC[C@H]2Cc2ccncc2)cc1.
What is the InChIKey of 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea?
The InChIKey is ALJMHTQFRRAVGP-SJLPKXTDSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-2-14-3-5-17(6-4-14)21-19(23)22-18-13-24-12-16(18)11-15-7-9-20-10-8-15/h3-10,16,18H,2,11-13H2,1H3,(H2,21,22,23)/t16-,18-/m1/s1.
What are the key properties of 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea?
1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea has a molecular weight of 325.41 g/mol, XLogP of 3.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylphenyl)-3-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]urea is sourced from PubChem (CID 156584114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).