About 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene
1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene (PubChem CID 156587175) has the molecular formula C9H8BrClF2O
and a molecular weight of 285.51 g/mol. Its IUPAC name is 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene |
| PubChem CID | 156587175 |
| Molecular Formula | C9H8BrClF2O |
| Molecular Weight | 285.51 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene |
| SMILES | CC(F)(F)COc1cccc(Br)c1Cl |
| InChI | InChI=1S/C9H8BrClF2O/c1-9(12,13)5-14-7-4-2-3-6(10)8(7)11/h2-4H,5H2,1H3 |
| InChIKey | MAQZCMXJIFMIJH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene?
The IUPAC name of 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene (CID 156587175) is 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene.
What is the SMILES notation for 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene?
The canonical SMILES for 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene is CC(F)(F)COc1cccc(Br)c1Cl.
What is the InChIKey of 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene?
The InChIKey is MAQZCMXJIFMIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClF2O/c1-9(12,13)5-14-7-4-2-3-6(10)8(7)11/h2-4H,5H2,1H3.
What are the key properties of 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene?
1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene has a molecular weight of 285.51 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-chloro-3-(2,2-difluoropropoxy)benzene is sourced from PubChem (CID 156587175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).