About 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene
1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene (PubChem CID 164888657) has the molecular formula C9H7BrClF2IO
and a molecular weight of 411.41 g/mol. Its IUPAC name is 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene.
Molecular Properties
| Compound Name | 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene |
| PubChem CID | 164888657 |
| Molecular Formula | C9H7BrClF2IO |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 409.84 |
| IUPAC Name | 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene |
| SMILES | CC(F)(F)COc1cc(I)c(Br)cc1Cl |
| InChI | InChI=1S/C9H7BrClF2IO/c1-9(12,13)4-15-8-3-7(14)5(10)2-6(8)11/h2-3H,4H2,1H3 |
| InChIKey | DPSPYMGERWNDKZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene?
The IUPAC name of 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene (CID 164888657) is 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene.
What is the SMILES notation for 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene?
The canonical SMILES for 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene is CC(F)(F)COc1cc(I)c(Br)cc1Cl.
What is the InChIKey of 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene?
The InChIKey is DPSPYMGERWNDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrClF2IO/c1-9(12,13)4-15-8-3-7(14)5(10)2-6(8)11/h2-3H,4H2,1H3.
What are the key properties of 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene?
1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene has a molecular weight of 411.41 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene is sourced from PubChem (CID 164888657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).