C9H7BrClF2IO — CID 164888657
1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene (PubChem CID 164888657) has the molecular formula C9H7BrClF2IO and a molecular weight of 411.41 g/mol. Its IUPAC name is 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene.
| Compound Name | 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene |
|---|---|
| PubChem CID | 164888657 |
| Molecular Formula | C9H7BrClF2IO |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 409.84 |
| IUPAC Name | 1-bromo-5-chloro-4-(2,2-difluoropropoxy)-2-iodobenzene |
| SMILES | CC(F)(F)COc1cc(I)c(Br)cc1Cl |
| InChI | InChI=1S/C9H7BrClF2IO/c1-9(12,13)4-15-8-3-7(14)5(10)2-6(8)11/h2-3H,4H2,1H3 |
| InChIKey | DPSPYMGERWNDKZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|