C15H20N5O6S+ — CID 156593224
[5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene]azanium (PubChem CID 156593224) has the molecular formula C15H20N5O6S+ and a molecular weight of 398.42 g/mol. Its IUPAC name is [5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene]azanium.
| Compound Name | [5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene]azanium |
|---|---|
| PubChem CID | 156593224 |
| Molecular Formula | C15H20N5O6S+ |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [5-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonyl-1,3-dimethyl-2,6-dioxo-1,3-diazinan-4-ylidene]azanium |
| SMILES | CN1C(=[NH2+])C(S(=O)(=O)N2CCN(C(=O)c3ccco3)CC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C15H19N5O6S/c1-17-12(16)11(14(22)18(2)15(17)23)27(24,25)20-7-5-19(6-8-20)13(21)10-4-3-9-26-10/h3-4,9,11,16H,5-8H2,1-2H3/p+1 |
| InChIKey | JTMQHMALFZXROI-UHFFFAOYSA-O |
| XLogP | -2.58 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|