C15H10F3N3O3S — CID 156607462
2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 156607462) has the molecular formula C15H10F3N3O3S and a molecular weight of 369.32 g/mol. Its IUPAC name is 2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 156607462 |
| Molecular Formula | C15H10F3N3O3S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | O=C(NC(Cc1cc(F)c(F)c(F)c1)C(=O)O)c1cn2ccsc2n1 |
| InChI | InChI=1S/C15H10F3N3O3S/c16-8-3-7(4-9(17)12(8)18)5-10(14(23)24)19-13(22)11-6-21-1-2-25-15(21)20-11/h1-4,6,10H,5H2,(H,19,22)(H,23,24) |
| InChIKey | WNSFAEVACHSLNB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|