C15H19ClN2O — CID 156608080
N-[2-(4-chlorophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 156608080) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 156608080 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)N1CC2CCC1C2 |
| InChI | InChI=1S/C15H19ClN2O/c16-13-4-1-11(2-5-13)7-8-17-15(19)18-10-12-3-6-14(18)9-12/h1-2,4-5,12,14H,3,6-10H2,(H,17,19) |
| InChIKey | QZZDHNXXUVKRHE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |