About N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide
N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide (PubChem CID 156609073) has the molecular formula C12H18N2O4S
and a molecular weight of 286.35 g/mol. Its IUPAC name is N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide |
| PubChem CID | 156609073 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide |
| SMILES | COC1CS(=O)(=O)CC1NC(=O)c1ccn(C)c1C |
| InChI | InChI=1S/C12H18N2O4S/c1-8-9(4-5-14(8)2)12(15)13-10-6-19(16,17)7-11(10)18-3/h4-5,10-11H,6-7H2,1-3H3,(H,13,15) |
| InChIKey | PNVAJTULZYKFKX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide?
The IUPAC name of N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide (CID 156609073) is N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide.
What is the SMILES notation for N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide?
The canonical SMILES for N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide is COC1CS(=O)(=O)CC1NC(=O)c1ccn(C)c1C.
What is the InChIKey of N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide?
The InChIKey is PNVAJTULZYKFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-8-9(4-5-14(8)2)12(15)13-10-6-19(16,17)7-11(10)18-3/h4-5,10-11H,6-7H2,1-3H3,(H,13,15).
What are the key properties of N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide?
N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide has a molecular weight of 286.35 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-1,1-dioxothiolan-3-yl)-1,2-dimethylpyrrole-3-carboxamide is sourced from PubChem (CID 156609073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).