C21H21NO4 — CID 156612677
1-(1,3-benzodioxol-5-yl)-2-(2-hydroxyphenyl)-2-azaspiro[3.5]nonan-3-one (PubChem CID 156612677) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2-hydroxyphenyl)-2-azaspiro[3.5]nonan-3-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2-hydroxyphenyl)-2-azaspiro[3.5]nonan-3-one |
|---|---|
| PubChem CID | 156612677 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2-hydroxyphenyl)-2-azaspiro[3.5]nonan-3-one |
| SMILES | O=C1N(c2ccccc2O)C(c2ccc3c(c2)OCO3)C12CCCCC2 |
| InChI | InChI=1S/C21H21NO4/c23-16-7-3-2-6-15(16)22-19(21(20(22)24)10-4-1-5-11-21)14-8-9-17-18(12-14)26-13-25-17/h2-3,6-9,12,19,23H,1,4-5,10-11,13H2 |
| InChIKey | AEDPUWYEADEMJY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |