C16H32F6N2O4S2 — CID 156613289
bis(trifluoromethylsulfonyl)azanide;dodecyl(dimethyl)azanium (PubChem CID 156613289) has the molecular formula C16H32F6N2O4S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;dodecyl(dimethyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;dodecyl(dimethyl)azanium |
|---|---|
| PubChem CID | 156613289 |
| Molecular Formula | C16H32F6N2O4S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;dodecyl(dimethyl)azanium |
| SMILES | CCCCCCCCCCCC[NH+](C)C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H31N.C2F6NO4S2/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-14H2,1-3H3;/q;-1/p+1 |
| InChIKey | XUBKMLZCJLXZHH-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|