C13H11N3O3S — CID 156621287
imidazo[1,2-c]pyrimidin-5-yl 4-methylbenzenesulfonate (PubChem CID 156621287) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is imidazo[1,2-c]pyrimidin-5-yl 4-methylbenzenesulfonate.
| Compound Name | imidazo[1,2-c]pyrimidin-5-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 156621287 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | imidazo[1,2-c]pyrimidin-5-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nccc3nccn23)cc1 |
| InChI | InChI=1S/C13H11N3O3S/c1-10-2-4-11(5-3-10)20(17,18)19-13-15-7-6-12-14-8-9-16(12)13/h2-9H,1H3 |
| InChIKey | UQSJKOQBQJIUAT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|