C36H35F6IrN2O2S- — CID 156621950
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-1,1,1,6,6,6-hexafluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one;iridium (PubChem CID 156621950) has the molecular formula C36H35F6IrN2O2S- and a molecular weight of 865.96 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-1,1,1,6,6,6-hexafluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one;iridium.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-1,1,1,6,6,6-hexafluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one;iridium |
|---|---|
| PubChem CID | 156621950 |
| Molecular Formula | C36H35F6IrN2O2S- |
| Molecular Weight | 865.96 g/mol |
| Exact Mass | 866.20 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidine;(Z)-1,1,1,6,6,6-hexafluoro-5-hydroxy-2,2-dimethylhex-4-en-3-one;iridium |
| SMILES | CC(C)(C(=O)/C=C(\O)C(F)(F)F)C(F)(F)F.CC(C)Cc1cccc2c1sc1c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)ncnc12.[Ir] |
| InChI | InChI=1S/C28H27N2S.C8H8F6O2.Ir/c1-17(2)13-19-10-8-12-22-25-27(31-26(19)22)24(29-16-30-25)20-14-18-9-6-7-11-21(18)23(15-20)28(3,4)5;1-6(2,8(12,13)14)4(15)3-5(16)7(9,10)11;/h6-12,15-17H,13H2,1-5H3;3,16H,1-2H3;/q-1;;/b;5-3-; |
| InChIKey | NSCXEGWRKKTMHH-FMFSYIAASA-N |
| XLogP | 11.11 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.96 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|