C35H39F6IrN2O2S- — CID 156621967
4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-methyl-6-(3,3,3-trifluoropropyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-5-hydroxy-2,2,7-trimethyloct-4-en-3-one (PubChem CID 156621967) has the molecular formula C35H39F6IrN2O2S- and a molecular weight of 857.98 g/mol. Its IUPAC name is 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-methyl-6-(3,3,3-trifluoropropyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-5-hydroxy-2,2,7-trimethyloct-4-en-3-one.
| Compound Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-methyl-6-(3,3,3-trifluoropropyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-5-hydroxy-2,2,7-trimethyloct-4-en-3-one |
|---|---|
| PubChem CID | 156621967 |
| Molecular Formula | C35H39F6IrN2O2S- |
| Molecular Weight | 857.98 g/mol |
| Exact Mass | 858.23 |
| IUPAC Name | 4-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-7-methyl-6-(3,3,3-trifluoropropyl)thieno[3,2-d]pyrimidine;iridium;(Z)-1,1,1-trifluoro-5-hydroxy-2,2,7-trimethyloct-4-en-3-one |
| SMILES | CC(C)C/C(O)=C/C(=O)C(C)(C)C(F)(F)F.Cc1c(CCC(F)(F)F)sc2c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)ncnc12.[Ir] |
| InChI | InChI=1S/C24H22F3N2S.C11H17F3O2.Ir/c1-14-19(9-10-24(25,26)27)30-22-20(14)28-13-29-21(22)16-11-15-7-5-6-8-17(15)18(12-16)23(2,3)4;1-7(2)5-8(15)6-9(16)10(3,4)11(12,13)14;/h5-8,12-13H,9-10H2,1-4H3;6-7,15H,5H2,1-4H3;/q-1;;/b;8-6-; |
| InChIKey | QPEGPLJZISZABM-QBUDOIDPSA-N |
| XLogP | 11.04 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.98 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|