C10H10N4O4S — CID 156626095
(1Z)-N-methylsulfonyl-2-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]ethanimidate (PubChem CID 156626095) has the molecular formula C10H10N4O4S and a molecular weight of 282.28 g/mol. Its IUPAC name is (1Z)-N-methylsulfonyl-2-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]ethanimidate.
| Compound Name | (1Z)-N-methylsulfonyl-2-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]ethanimidate |
|---|---|
| PubChem CID | 156626095 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (1Z)-N-methylsulfonyl-2-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]ethanimidate |
| SMILES | CS(=O)(=O)/N=C(\[O-])C[n+]1ccc(-c2ncco2)cn1 |
| InChI | InChI=1S/C10H10N4O4S/c1-19(16,17)13-9(15)7-14-4-2-8(6-12-14)10-11-3-5-18-10/h2-6H,7H2,1H3 |
| InChIKey | JLZSAJXBTGOSAV-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 112.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|