C13H15N4O4+ — CID 156626098
3-[4-[4-methyl-5-(methylcarbamoyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 156626098) has the molecular formula C13H15N4O4+ and a molecular weight of 291.29 g/mol. Its IUPAC name is 3-[4-[4-methyl-5-(methylcarbamoyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-[4-methyl-5-(methylcarbamoyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 156626098 |
| Molecular Formula | C13H15N4O4+ |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[4-[4-methyl-5-(methylcarbamoyl)-1,3-oxazol-2-yl]pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | CNC(=O)c1oc(-c2cc[n+](CCC(=O)O)nc2)nc1C |
| InChI | InChI=1S/C13H14N4O4/c1-8-11(12(20)14-2)21-13(16-8)9-3-5-17(15-7-9)6-4-10(18)19/h3,5,7H,4,6H2,1-2H3,(H-,14,18,19,20)/p+1 |
| InChIKey | XVZRQMBLEHXMQD-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|