C50H42N4O12 — CID 156627219
[4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]phenyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 156627219) has the molecular formula C50H42N4O12 and a molecular weight of 890.90 g/mol. Its IUPAC name is [4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]phenyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]phenyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 156627219 |
| Molecular Formula | C50H42N4O12 |
| Molecular Weight | 890.90 g/mol |
| Exact Mass | 890.28 |
| IUPAC Name | [4-[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]phenyl] 2-[6-(2,5-dioxopyrrol-1-yl)hexyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc(OC(=O)c3ccc4c(c3)C(=O)N(CCCCCCN3C(=O)C=CC3=O)C4=O)cc2)cc1)c1ccc2c(c1)C(=O)N(CCCCCCN1C(=O)C=CC1=O)C2=O |
| InChI | InChI=1S/C50H42N4O12/c55-41-21-22-42(56)51(41)25-5-1-3-7-27-53-45(59)37-19-13-33(29-39(37)47(53)61)49(63)65-35-15-9-31(10-16-35)32-11-17-36(18-12-32)66-50(64)34-14-20-38-40(30-34)48(62)54(46(38)60)28-8-4-2-6-26-52-43(57)23-24-44(52)58/h9-24,29-30H,1-8,25-28H2 |
| InChIKey | KNHKWXWOGWUEJN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 202.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.90 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|