C30H24O6S2 — CID 156628125
2-[10-(2-carboxylato-4-methoxy-5-methylphenyl)thianthrene-5,10-diium-5-yl]-5-methoxy-4-methylbenzoate (PubChem CID 156628125) has the molecular formula C30H24O6S2 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-[10-(2-carboxylato-4-methoxy-5-methylphenyl)thianthrene-5,10-diium-5-yl]-5-methoxy-4-methylbenzoate.
| Compound Name | 2-[10-(2-carboxylato-4-methoxy-5-methylphenyl)thianthrene-5,10-diium-5-yl]-5-methoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 156628125 |
| Molecular Formula | C30H24O6S2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[10-(2-carboxylato-4-methoxy-5-methylphenyl)thianthrene-5,10-diium-5-yl]-5-methoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)[O-])c([S+]2c3ccccc3[S+](c3cc(C)c(OC)cc3C(=O)[O-])c3ccccc32)cc1C |
| InChI | InChI=1S/C30H24O6S2/c1-17-13-27(19(29(31)32)15-21(17)35-3)37-23-9-5-7-11-25(23)38(26-12-8-6-10-24(26)37)28-14-18(2)22(36-4)16-20(28)30(33)34/h5-16H,1-4H3 |
| InChIKey | NESKTZFIVVNHTP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|