C23H25NO4 — CID 156629390
methyl (2S,3R,6S)-3,6-dimethyl-5-methylidene-4-oxo-2-[(N-phenylanilino)methyl]oxane-3-carboxylate (PubChem CID 156629390) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl (2S,3R,6S)-3,6-dimethyl-5-methylidene-4-oxo-2-[(N-phenylanilino)methyl]oxane-3-carboxylate.
| Compound Name | methyl (2S,3R,6S)-3,6-dimethyl-5-methylidene-4-oxo-2-[(N-phenylanilino)methyl]oxane-3-carboxylate |
|---|---|
| PubChem CID | 156629390 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | methyl (2S,3R,6S)-3,6-dimethyl-5-methylidene-4-oxo-2-[(N-phenylanilino)methyl]oxane-3-carboxylate |
| SMILES | C=C1C(=O)[C@](C)(C(=O)OC)[C@@H](CN(c2ccccc2)c2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C23H25NO4/c1-16-17(2)28-20(23(3,21(16)25)22(26)27-4)15-24(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20H,1,15H2,2-4H3/t17-,20+,23+/m0/s1 |
| InChIKey | ZTTXLZDAXPAYLT-XTQVGHSUSA-N |
| XLogP | 3.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|