C22H19NO4 — CID 138978408
methyl (2S,2'R,3'S)-3-oxo-3'-phenyl-2'-prop-2-enylspiro[1-benzofuran-2,4'-3H-pyrrole]-2'-carboxylate (PubChem CID 138978408) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl (2S,2'R,3'S)-3-oxo-3'-phenyl-2'-prop-2-enylspiro[1-benzofuran-2,4'-3H-pyrrole]-2'-carboxylate.
| Compound Name | methyl (2S,2'R,3'S)-3-oxo-3'-phenyl-2'-prop-2-enylspiro[1-benzofuran-2,4'-3H-pyrrole]-2'-carboxylate |
|---|---|
| PubChem CID | 138978408 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl (2S,2'R,3'S)-3-oxo-3'-phenyl-2'-prop-2-enylspiro[1-benzofuran-2,4'-3H-pyrrole]-2'-carboxylate |
| SMILES | C=CC[C@@]1(C(=O)OC)N=C[C@@]2(Oc3ccccc3C2=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c1-3-13-21(20(25)26-2)18(15-9-5-4-6-10-15)22(14-23-21)19(24)16-11-7-8-12-17(16)27-22/h3-12,14,18H,1,13H2,2H3/t18-,21+,22+/m0/s1 |
| InChIKey | ULLQRLPSSOCSOR-VLCRHTCISA-N |
| XLogP | 3.36 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|