C22H21ClO4 — CID 135026926
methyl (3S,4S,6S)-4-(4-chlorophenyl)-2-oxo-6-phenyl-6-prop-2-enyloxane-3-carboxylate (PubChem CID 135026926) has the molecular formula C22H21ClO4 and a molecular weight of 384.86 g/mol. Its IUPAC name is methyl (3S,4S,6S)-4-(4-chlorophenyl)-2-oxo-6-phenyl-6-prop-2-enyloxane-3-carboxylate.
| Compound Name | methyl (3S,4S,6S)-4-(4-chlorophenyl)-2-oxo-6-phenyl-6-prop-2-enyloxane-3-carboxylate |
|---|---|
| PubChem CID | 135026926 |
| Molecular Formula | C22H21ClO4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | methyl (3S,4S,6S)-4-(4-chlorophenyl)-2-oxo-6-phenyl-6-prop-2-enyloxane-3-carboxylate |
| SMILES | C=CC[C@@]1(c2ccccc2)C[C@H](c2ccc(Cl)cc2)[C@@H](C(=O)OC)C(=O)O1 |
| InChI | InChI=1S/C22H21ClO4/c1-3-13-22(16-7-5-4-6-8-16)14-18(15-9-11-17(23)12-10-15)19(20(24)26-2)21(25)27-22/h3-12,18-19H,1,13-14H2,2H3/t18-,19+,22+/m1/s1 |
| InChIKey | UXXFJQIIDJAFEU-DXIQSLLYSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|