C21H14ClN3O4 — CID 156631087
2-[8-chloro-2-(3-methoxyphenyl)-4-oxo-1H-chromeno[4,3-b]pyrrol-3-yl]-2-cyanoacetamide (PubChem CID 156631087) has the molecular formula C21H14ClN3O4 and a molecular weight of 407.81 g/mol. Its IUPAC name is 2-[8-chloro-2-(3-methoxyphenyl)-4-oxo-1H-chromeno[4,3-b]pyrrol-3-yl]-2-cyanoacetamide.
| Compound Name | 2-[8-chloro-2-(3-methoxyphenyl)-4-oxo-1H-chromeno[4,3-b]pyrrol-3-yl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 156631087 |
| Molecular Formula | C21H14ClN3O4 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[8-chloro-2-(3-methoxyphenyl)-4-oxo-1H-chromeno[4,3-b]pyrrol-3-yl]-2-cyanoacetamide |
| SMILES | COc1cccc(-c2[nH]c3c(c2C(C#N)C(N)=O)c(=O)oc2ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C21H14ClN3O4/c1-28-12-4-2-3-10(7-12)18-16(14(9-23)20(24)26)17-19(25-18)13-8-11(22)5-6-15(13)29-21(17)27/h2-8,14,25H,1H3,(H2,24,26) |
| InChIKey | ARBRQZTXJYPGSI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|