C28H27N3O5 — CID 156631193
N-[2-(4-methoxyanilino)-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]benzamide (PubChem CID 156631193) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[2-(4-methoxyanilino)-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]benzamide.
| Compound Name | N-[2-(4-methoxyanilino)-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 156631193 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[2-(4-methoxyanilino)-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]benzamide |
| SMILES | COc1ccc(Nc2ncc(-c3cc(OC)c(OC)c(OC)c3)cc2NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27N3O5/c1-33-22-12-10-21(11-13-22)30-27-23(31-28(32)18-8-6-5-7-9-18)14-20(17-29-27)19-15-24(34-2)26(36-4)25(16-19)35-3/h5-17H,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | KEHHYMQZIWVILR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |