C16H30N4O6S — CID 156632030
2-[[2-[[4-amino-5-(dipropylamino)oxy-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 156632030) has the molecular formula C16H30N4O6S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[[2-[[4-amino-5-(dipropylamino)oxy-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[4-amino-5-(dipropylamino)oxy-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 156632030 |
| Molecular Formula | C16H30N4O6S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[[2-[[4-amino-5-(dipropylamino)oxy-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | CCCN(CCC)OC(=O)C(N)CCC(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H30N4O6S/c1-3-7-20(8-4-2)26-16(25)11(17)5-6-13(21)19-12(10-27)15(24)18-9-14(22)23/h11-12,27H,3-10,17H2,1-2H3,(H,18,24)(H,19,21)(H,22,23) |
| InChIKey | BLLYNUAOQAAVHP-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|