C12H19N3O6S — CID 141422233
2-[[2-[(4-amino-5-ethenoxy-5-oxopentanoyl)amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 141422233) has the molecular formula C12H19N3O6S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-[[2-[(4-amino-5-ethenoxy-5-oxopentanoyl)amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(4-amino-5-ethenoxy-5-oxopentanoyl)amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 141422233 |
| Molecular Formula | C12H19N3O6S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-[[2-[(4-amino-5-ethenoxy-5-oxopentanoyl)amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | C=COC(=O)C(N)CCC(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H19N3O6S/c1-2-21-12(20)7(13)3-4-9(16)15-8(6-22)11(19)14-5-10(17)18/h2,7-8,22H,1,3-6,13H2,(H,14,19)(H,15,16)(H,17,18) |
| InChIKey | BZZGITOAYBNHBJ-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|