C13H23N4O7S2Se — CID 90424716
CID 90424716 (PubChem CID 90424716) has the molecular formula C13H23N4O7S2Se and a molecular weight of 490.44 g/mol.
| Compound Name | CID 90424716 |
|---|---|
| PubChem CID | 90424716 |
| Molecular Formula | C13H23N4O7S2Se |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | — |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)[Se].N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C10H16N3O5SSe.C3H7NO2S/c11-5(10(18)20)1-2-7(14)13-6(4-19)9(17)12-3-8(15)16;4-2(1-7)3(5)6/h5-6,19H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16);2,7H,1,4H2,(H,5,6)/t5-,6-;2-/m00/s1 |
| InChIKey | QNUREYUJVFIQPK-UKSKFBDSSA-N |
| XLogP | -3.27 |
| TPSA | 201.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|