C23H39IO6Si — CID 156633763
[(2S,3S,4Z,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] hydrogen carbonate (PubChem CID 156633763) has the molecular formula C23H39IO6Si and a molecular weight of 566.55 g/mol. Its IUPAC name is [(2S,3S,4Z,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] hydrogen carbonate.
| Compound Name | [(2S,3S,4Z,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 156633763 |
| Molecular Formula | C23H39IO6Si |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [(2S,3S,4Z,6R,7S,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-1-iodoprop-1-en-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] hydrogen carbonate |
| SMILES | C/C(=C\I)[C@H]1OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@H](C)[C@@H](OC(=O)O)/C=C\[C@@H]1C |
| InChI | InChI=1S/C23H39IO6Si/c1-15-9-11-18(30-31(7,8)23(4,5)6)13-20(25)29-21(17(3)14-24)16(2)10-12-19(15)28-22(26)27/h10,12,14-16,18-19,21H,9,11,13H2,1-8H3,(H,26,27)/b12-10-,17-14+/t15-,16-,18+,19-,21-/m0/s1 |
| InChIKey | WVLBQLILWMUQGW-DANWUXPYSA-N |
| XLogP | 6.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|