C28H43ClN6O5 — CID 156636468
N-[(1S,2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(chloromethyl)anilino]-1-oxopentan-2-yl]amino]-1-hydroxy-3-methylbutan-2-yl]-6-(5-oxo-2H-pyrrol-1-yl)hexanamide (PubChem CID 156636468) has the molecular formula C28H43ClN6O5 and a molecular weight of 579.14 g/mol. Its IUPAC name is N-[(1S,2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(chloromethyl)anilino]-1-oxopentan-2-yl]amino]-1-hydroxy-3-methylbutan-2-yl]-6-(5-oxo-2H-pyrrol-1-yl)hexanamide.
| Compound Name | N-[(1S,2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(chloromethyl)anilino]-1-oxopentan-2-yl]amino]-1-hydroxy-3-methylbutan-2-yl]-6-(5-oxo-2H-pyrrol-1-yl)hexanamide |
|---|---|
| PubChem CID | 156636468 |
| Molecular Formula | C28H43ClN6O5 |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | N-[(1S,2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(chloromethyl)anilino]-1-oxopentan-2-yl]amino]-1-hydroxy-3-methylbutan-2-yl]-6-(5-oxo-2H-pyrrol-1-yl)hexanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1CC=CC1=O)[C@H](O)N[C@@H](CCCNC(N)=O)C(=O)Nc1ccc(CCl)cc1 |
| InChI | InChI=1S/C28H43ClN6O5/c1-19(2)25(34-23(36)9-4-3-5-16-35-17-7-10-24(35)37)27(39)33-22(8-6-15-31-28(30)40)26(38)32-21-13-11-20(18-29)12-14-21/h7,10-14,19,22,25,27,33,39H,3-6,8-9,15-18H2,1-2H3,(H,32,38)(H,34,36)(H3,30,31,40)/t22-,25-,27-/m0/s1 |
| InChIKey | DYEMYAQPFSYLRV-LNBJVWSJSA-N |
| XLogP | 2.19 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|