C30H33Cl2N3O4 — CID 156638368
N-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-phenylpropanamide (PubChem CID 156638368) has the molecular formula C30H33Cl2N3O4 and a molecular weight of 570.52 g/mol. Its IUPAC name is N-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-phenylpropanamide.
| Compound Name | N-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 156638368 |
| Molecular Formula | C30H33Cl2N3O4 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | N-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-phenylpropanamide |
| SMILES | C[C@]1(c2ccc(Cl)cc2Cl)OC[C@@H](COc2ccc(N3CCN(NC(=O)CCc4ccccc4)CC3)cc2)O1 |
| InChI | InChI=1S/C30H33Cl2N3O4/c1-30(27-13-8-23(31)19-28(27)32)38-21-26(39-30)20-37-25-11-9-24(10-12-25)34-15-17-35(18-16-34)33-29(36)14-7-22-5-3-2-4-6-22/h2-6,8-13,19,26H,7,14-18,20-21H2,1H3,(H,33,36)/t26-,30+/m1/s1 |
| InChIKey | KQAAGNZTRNTLLU-VIZCGCQYSA-N |
| XLogP | 5.45 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|