C33H34Cl2N2O5 — CID 165382563
(E)-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-(3-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 165382563) has the molecular formula C33H34Cl2N2O5 and a molecular weight of 609.55 g/mol. Its IUPAC name is (E)-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-(3-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-(3-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 165382563 |
| Molecular Formula | C33H34Cl2N2O5 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | (E)-1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-(3-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1cccc(/C=C/C(=O)N2CCN(c3ccc(OC[C@@H]4CO[C@](C)(c5ccc(Cl)cc5Cl)O4)cc3)CC2)c1 |
| InChI | InChI=1S/C33H34Cl2N2O5/c1-3-19-39-28-6-4-5-24(20-28)7-14-32(38)37-17-15-36(16-18-37)26-9-11-27(12-10-26)40-22-29-23-41-33(2,42-29)30-13-8-25(34)21-31(30)35/h3-14,20-21,29H,1,15-19,22-23H2,2H3/b14-7+/t29-,33+/m1/s1 |
| InChIKey | VMAZAXCEUAETTD-NZUKSXQESA-N |
| XLogP | 6.59 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|