C29H32Cl2N4O5 — CID 156638374
1,3-dichlorobenzene;N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[4-[(2-methyl-1,3-dioxolan-4-yl)methoxy]phenyl]piperazine-1-carboxamide (PubChem CID 156638374) has the molecular formula C29H32Cl2N4O5 and a molecular weight of 587.50 g/mol. Its IUPAC name is 1,3-dichlorobenzene;N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[4-[(2-methyl-1,3-dioxolan-4-yl)methoxy]phenyl]piperazine-1-carboxamide.
| Compound Name | 1,3-dichlorobenzene;N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[4-[(2-methyl-1,3-dioxolan-4-yl)methoxy]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 156638374 |
| Molecular Formula | C29H32Cl2N4O5 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 1,3-dichlorobenzene;N-[(E)-(3-hydroxyphenyl)methylideneamino]-4-[4-[(2-methyl-1,3-dioxolan-4-yl)methoxy]phenyl]piperazine-1-carboxamide |
| SMILES | CC1OCC(COc2ccc(N3CCN(C(=O)N/N=C/c4cccc(O)c4)CC3)cc2)O1.Clc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H28N4O5.C6H4Cl2/c1-17-30-15-22(32-17)16-31-21-7-5-19(6-8-21)26-9-11-27(12-10-26)23(29)25-24-14-18-3-2-4-20(28)13-18;7-5-2-1-3-6(8)4-5/h2-8,13-14,17,22,28H,9-12,15-16H2,1H3,(H,25,29);1-4H/b24-14+; |
| InChIKey | NQZKMIACKRRUOP-SXMBIPSUSA-N |
| XLogP | 5.39 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|