C26H32Cl2N4O3S — CID 144680469
1,3-dichlorobenzene;1-ethylsulfanyl-4-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine (PubChem CID 144680469) has the molecular formula C26H32Cl2N4O3S and a molecular weight of 551.54 g/mol. Its IUPAC name is 1,3-dichlorobenzene;1-ethylsulfanyl-4-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine.
| Compound Name | 1,3-dichlorobenzene;1-ethylsulfanyl-4-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine |
|---|---|
| PubChem CID | 144680469 |
| Molecular Formula | C26H32Cl2N4O3S |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 1,3-dichlorobenzene;1-ethylsulfanyl-4-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazine |
| SMILES | CCSN1CCN(c2ccc(OCC3COC(Cn4ccnc4)O3)cc2)CC1.Clc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H28N4O3S.C6H4Cl2/c1-2-28-24-11-9-23(10-12-24)17-3-5-18(6-4-17)25-14-19-15-26-20(27-19)13-22-8-7-21-16-22;7-5-2-1-3-6(8)4-5/h3-8,16,19-20H,2,9-15H2,1H3;1-4H |
| InChIKey | VQSCLKBJFQQUJN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 51.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|