C19H23F3N4O4S — CID 144680460
1-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(trifluoromethylsulfinyl)piperazine (PubChem CID 144680460) has the molecular formula C19H23F3N4O4S and a molecular weight of 460.48 g/mol. Its IUPAC name is 1-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(trifluoromethylsulfinyl)piperazine.
| Compound Name | 1-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(trifluoromethylsulfinyl)piperazine |
|---|---|
| PubChem CID | 144680460 |
| Molecular Formula | C19H23F3N4O4S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 1-[4-[[2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-4-(trifluoromethylsulfinyl)piperazine |
| SMILES | O=S(N1CCN(c2ccc(OCC3COC(Cn4ccnc4)O3)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C19H23F3N4O4S/c20-19(21,22)31(27)26-9-7-25(8-10-26)15-1-3-16(4-2-15)28-12-17-13-29-18(30-17)11-24-6-5-23-14-24/h1-6,14,17-18H,7-13H2 |
| InChIKey | OUBIZRFABNWILO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|