C29H37N7O4 — CID 145098558
1-propan-2-yl-3-[4-[4-[4-[[4-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidin-2-one (PubChem CID 145098558) has the molecular formula C29H37N7O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is 1-propan-2-yl-3-[4-[4-[4-[[4-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidin-2-one.
| Compound Name | 1-propan-2-yl-3-[4-[4-[4-[[4-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 145098558 |
| Molecular Formula | C29H37N7O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 1-propan-2-yl-3-[4-[4-[4-[[4-(triazol-2-ylmethyl)-1,3-dioxolan-2-yl]methoxy]phenyl]piperazin-1-yl]phenyl]imidazolidin-2-one |
| SMILES | CC(C)N1CCN(c2ccc(N3CCN(c4ccc(OCC5OCC(Cn6nccn6)O5)cc4)CC3)cc2)C1=O |
| InChI | InChI=1S/C29H37N7O4/c1-22(2)34-17-18-35(29(34)37)25-5-3-23(4-6-25)32-13-15-33(16-14-32)24-7-9-26(10-8-24)38-21-28-39-20-27(40-28)19-36-30-11-12-31-36/h3-12,22,27-28H,13-21H2,1-2H3 |
| InChIKey | RDRPNAUJRSZKDZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|