C35H70S — CID 156639906
ethane;heptane;10-hex-1-en-2-ylsulfanyl-2-methylnonadeca-1,18-diene (PubChem CID 156639906) has the molecular formula C35H70S and a molecular weight of 523.01 g/mol. Its IUPAC name is ethane;heptane;10-hex-1-en-2-ylsulfanyl-2-methylnonadeca-1,18-diene.
| Compound Name | ethane;heptane;10-hex-1-en-2-ylsulfanyl-2-methylnonadeca-1,18-diene |
|---|---|
| PubChem CID | 156639906 |
| Molecular Formula | C35H70S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.52 |
| IUPAC Name | ethane;heptane;10-hex-1-en-2-ylsulfanyl-2-methylnonadeca-1,18-diene |
| SMILES | C=CCCCCCCCC(CCCCCCCC(=C)C)SC(=C)CCCC.CC.CCCCCCC |
| InChI | InChI=1S/C26H48S.C7H16.C2H6/c1-6-8-10-11-12-15-18-22-26(27-25(5)21-9-7-2)23-19-16-13-14-17-20-24(3)4;1-3-5-7-6-4-2;1-2/h6,26H,1,3,5,7-23H2,2,4H3;3-7H2,1-2H3;1-2H3 |
| InChIKey | KROGGTNBZHNCEP-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|