C20H37NO4 — CID 156647059
2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methoxymethane (PubChem CID 156647059) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is 2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methoxymethane.
| Compound Name | 2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methoxymethane |
|---|---|
| PubChem CID | 156647059 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methoxymethane |
| SMILES | C=C1CC(CC(=O)NCC2CCC(C)(C)CO2)OC(C)[C@@H]1C.COC |
| InChI | InChI=1S/C18H31NO3.C2H6O/c1-12-8-16(22-14(3)13(12)2)9-17(20)19-10-15-6-7-18(4,5)11-21-15;1-3-2/h13-16H,1,6-11H2,2-5H3,(H,19,20);1-2H3/t13-,14?,15?,16?;/m1./s1 |
| InChIKey | RLEBARFGGMEQIG-YNEVMNPDSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|