C18H28ClN3O2 — CID 156651706
tert-butyl 4-[(6-chloro-5-methyl-3-pyridinyl)methyl]-3,3-dimethylpiperazine-1-carboxylate (PubChem CID 156651706) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is tert-butyl 4-[(6-chloro-5-methyl-3-pyridinyl)methyl]-3,3-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-chloro-5-methyl-3-pyridinyl)methyl]-3,3-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 156651706 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | tert-butyl 4-[(6-chloro-5-methyl-3-pyridinyl)methyl]-3,3-dimethylpiperazine-1-carboxylate |
| SMILES | Cc1cc(CN2CCN(C(=O)OC(C)(C)C)CC2(C)C)cnc1Cl |
| InChI | InChI=1S/C18H28ClN3O2/c1-13-9-14(10-20-15(13)19)11-22-8-7-21(12-18(22,5)6)16(23)24-17(2,3)4/h9-10H,7-8,11-12H2,1-6H3 |
| InChIKey | XWRRZRMWERDQGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|