C16H20F3N3O6 — CID 156654348
[4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]-3-oxomorpholin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 156654348) has the molecular formula C16H20F3N3O6 and a molecular weight of 407.35 g/mol. Its IUPAC name is [4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]-3-oxomorpholin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]-3-oxomorpholin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156654348 |
| Molecular Formula | C16H20F3N3O6 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [4-[[2-(dimethoxymethyl)-6-(methylamino)-3-pyridinyl]methyl]-3-oxomorpholin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CNc1ccc(CN2CCOC(OC(=O)C(F)(F)F)C2=O)c(C(OC)OC)n1 |
| InChI | InChI=1S/C16H20F3N3O6/c1-20-10-5-4-9(11(21-10)13(25-2)26-3)8-22-6-7-27-14(12(22)23)28-15(24)16(17,18)19/h4-5,13-14H,6-8H2,1-3H3,(H,20,21) |
| InChIKey | IUDDNUHLZPPFCW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|